C28H25N3O4 — CID 121062816
N-[2-[[4-[[2-(4-phenylphenyl)acetyl]amino]benzoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 121062816) has the molecular formula C28H25N3O4 and a molecular weight of 467.53 g/mol. Its IUPAC name is N-[2-[[4-[[2-(4-phenylphenyl)acetyl]amino]benzoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[4-[[2-(4-phenylphenyl)acetyl]amino]benzoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 121062816 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N-[2-[[4-[[2-(4-phenylphenyl)acetyl]amino]benzoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)Nc1ccc(C(=O)NCCNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C28H25N3O4/c32-26(19-20-8-10-22(11-9-20)21-5-2-1-3-6-21)31-24-14-12-23(13-15-24)27(33)29-16-17-30-28(34)25-7-4-18-35-25/h1-15,18H,16-17,19H2,(H,29,33)(H,30,34)(H,31,32) |
| InChIKey | RDUJIEBZILDCOE-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|