C16H18N2O3 — CID 134052250
N-[2-[(4-ethylbenzoyl)amino]ethyl]furan-2-carboxamide (PubChem CID 134052250) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-[2-[(4-ethylbenzoyl)amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(4-ethylbenzoyl)amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 134052250 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-[2-[(4-ethylbenzoyl)amino]ethyl]furan-2-carboxamide |
| SMILES | CCc1ccc(C(=O)NCCNC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C16H18N2O3/c1-2-12-5-7-13(8-6-12)15(19)17-9-10-18-16(20)14-4-3-11-21-14/h3-8,11H,2,9-10H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | BVUSNTOJTVHNTB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|