C23H25N3O6S — CID 24660944
N-[2-[[3-[(4-ethylphenyl)sulfamoyl]-4-methoxybenzoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 24660944) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is N-[2-[[3-[(4-ethylphenyl)sulfamoyl]-4-methoxybenzoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[3-[(4-ethylphenyl)sulfamoyl]-4-methoxybenzoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 24660944 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[2-[[3-[(4-ethylphenyl)sulfamoyl]-4-methoxybenzoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | CCc1ccc(NS(=O)(=O)c2cc(C(=O)NCCNC(=O)c3ccco3)ccc2OC)cc1 |
| InChI | InChI=1S/C23H25N3O6S/c1-3-16-6-9-18(10-7-16)26-33(29,30)21-15-17(8-11-19(21)31-2)22(27)24-12-13-25-23(28)20-5-4-14-32-20/h4-11,14-15,26H,3,12-13H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | AQCUZRJUODPWBS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|