C21H27N3O6S — CID 41153424
3-[[4-[2-(diethylazaniumyl)ethylcarbamoyl]phenyl]sulfamoyl]-4-methoxybenzoate (PubChem CID 41153424) has the molecular formula C21H27N3O6S and a molecular weight of 449.53 g/mol. Its IUPAC name is 3-[[4-[2-(diethylazaniumyl)ethylcarbamoyl]phenyl]sulfamoyl]-4-methoxybenzoate.
| Compound Name | 3-[[4-[2-(diethylazaniumyl)ethylcarbamoyl]phenyl]sulfamoyl]-4-methoxybenzoate |
|---|---|
| PubChem CID | 41153424 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 3-[[4-[2-(diethylazaniumyl)ethylcarbamoyl]phenyl]sulfamoyl]-4-methoxybenzoate |
| SMILES | CC[NH+](CC)CCNC(=O)c1ccc(NS(=O)(=O)c2cc(C(=O)[O-])ccc2OC)cc1 |
| InChI | InChI=1S/C21H27N3O6S/c1-4-24(5-2)13-12-22-20(25)15-6-9-17(10-7-15)23-31(28,29)19-14-16(21(26)27)8-11-18(19)30-3/h6-11,14,23H,4-5,12-13H2,1-3H3,(H,22,25)(H,26,27) |
| InChIKey | BGOJGAXPLKNJLM-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 129.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |