C11H14NO6S- — CID 2119868
4-methoxy-3-(2-methoxyethylsulfamoyl)benzoate (PubChem CID 2119868) has the molecular formula C11H14NO6S- and a molecular weight of 288.30 g/mol. Its IUPAC name is 4-methoxy-3-(2-methoxyethylsulfamoyl)benzoate.
| Compound Name | 4-methoxy-3-(2-methoxyethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2119868 |
| Molecular Formula | C11H14NO6S- |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 4-methoxy-3-(2-methoxyethylsulfamoyl)benzoate |
| SMILES | COCCNS(=O)(=O)c1cc(C(=O)[O-])ccc1OC |
| InChI | InChI=1S/C11H15NO6S/c1-17-6-5-12-19(15,16)10-7-8(11(13)14)3-4-9(10)18-2/h3-4,7,12H,5-6H2,1-2H3,(H,13,14)/p-1 |
| InChIKey | QEBWXIGRBWJXDP-UHFFFAOYSA-M |
| XLogP | -1.02 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|