C20H24N2O5S — CID 24560488
N-(2,3-dihydro-1H-inden-1-yl)-4-methoxy-3-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 24560488) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-1-yl)-4-methoxy-3-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | N-(2,3-dihydro-1H-inden-1-yl)-4-methoxy-3-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 24560488 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-1-yl)-4-methoxy-3-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1cc(C(=O)NC2CCc3ccccc32)ccc1OC |
| InChI | InChI=1S/C20H24N2O5S/c1-26-12-11-21-28(24,25)19-13-15(8-10-18(19)27-2)20(23)22-17-9-7-14-5-3-4-6-16(14)17/h3-6,8,10,13,17,21H,7,9,11-12H2,1-2H3,(H,22,23) |
| InChIKey | ZXZRXQVVDJJFQZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|