C20H31N3O6S — CID 30855583
4-methoxy-3-(2-methoxyethylsulfamoyl)-N-[1-(2-methylpropanoyl)piperidin-4-yl]benzamide (PubChem CID 30855583) has the molecular formula C20H31N3O6S and a molecular weight of 441.55 g/mol. Its IUPAC name is 4-methoxy-3-(2-methoxyethylsulfamoyl)-N-[1-(2-methylpropanoyl)piperidin-4-yl]benzamide.
| Compound Name | 4-methoxy-3-(2-methoxyethylsulfamoyl)-N-[1-(2-methylpropanoyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 30855583 |
| Molecular Formula | C20H31N3O6S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 4-methoxy-3-(2-methoxyethylsulfamoyl)-N-[1-(2-methylpropanoyl)piperidin-4-yl]benzamide |
| SMILES | COCCNS(=O)(=O)c1cc(C(=O)NC2CCN(C(=O)C(C)C)CC2)ccc1OC |
| InChI | InChI=1S/C20H31N3O6S/c1-14(2)20(25)23-10-7-16(8-11-23)22-19(24)15-5-6-17(29-4)18(13-15)30(26,27)21-9-12-28-3/h5-6,13-14,16,21H,7-12H2,1-4H3,(H,22,24) |
| InChIKey | ATMCTJATFDNIOU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|