C23H30ClN3O4S — CID 55387001
3-[(4-chlorophenyl)methylsulfamoyl]-4-methoxy-N-(1-propan-2-ylpiperidin-4-yl)benzamide (PubChem CID 55387001) has the molecular formula C23H30ClN3O4S and a molecular weight of 480.03 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)methylsulfamoyl]-4-methoxy-N-(1-propan-2-ylpiperidin-4-yl)benzamide.
| Compound Name | 3-[(4-chlorophenyl)methylsulfamoyl]-4-methoxy-N-(1-propan-2-ylpiperidin-4-yl)benzamide |
|---|---|
| PubChem CID | 55387001 |
| Molecular Formula | C23H30ClN3O4S |
| Molecular Weight | 480.03 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 3-[(4-chlorophenyl)methylsulfamoyl]-4-methoxy-N-(1-propan-2-ylpiperidin-4-yl)benzamide |
| SMILES | COc1ccc(C(=O)NC2CCN(C(C)C)CC2)cc1S(=O)(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H30ClN3O4S/c1-16(2)27-12-10-20(11-13-27)26-23(28)18-6-9-21(31-3)22(14-18)32(29,30)25-15-17-4-7-19(24)8-5-17/h4-9,14,16,20,25H,10-13,15H2,1-3H3,(H,26,28) |
| InChIKey | PBONYKSUWLGRLO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.03 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |