C17H24N2O6S — CID 110413308
ethyl 4-[(4-methoxy-3-methylsulfonylbenzoyl)amino]piperidine-1-carboxylate (PubChem CID 110413308) has the molecular formula C17H24N2O6S and a molecular weight of 384.45 g/mol. Its IUPAC name is ethyl 4-[(4-methoxy-3-methylsulfonylbenzoyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(4-methoxy-3-methylsulfonylbenzoyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110413308 |
| Molecular Formula | C17H24N2O6S |
| Molecular Weight | 384.45 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | ethyl 4-[(4-methoxy-3-methylsulfonylbenzoyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)c2ccc(OC)c(S(C)(=O)=O)c2)CC1 |
| InChI | InChI=1S/C17H24N2O6S/c1-4-25-17(21)19-9-7-13(8-10-19)18-16(20)12-5-6-14(24-2)15(11-12)26(3,22)23/h5-6,11,13H,4,7-10H2,1-3H3,(H,18,20) |
| InChIKey | YIKTVGXWRVEDAB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.45 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |