C19H28N2O5 — CID 108559158
butyl 4-[(3,4-dimethoxybenzoyl)amino]piperidine-1-carboxylate (PubChem CID 108559158) has the molecular formula C19H28N2O5 and a molecular weight of 364.44 g/mol. Its IUPAC name is butyl 4-[(3,4-dimethoxybenzoyl)amino]piperidine-1-carboxylate.
| Compound Name | butyl 4-[(3,4-dimethoxybenzoyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 108559158 |
| Molecular Formula | C19H28N2O5 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | butyl 4-[(3,4-dimethoxybenzoyl)amino]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(NC(=O)c2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C19H28N2O5/c1-4-5-12-26-19(23)21-10-8-15(9-11-21)20-18(22)14-6-7-16(24-2)17(13-14)25-3/h6-7,13,15H,4-5,8-12H2,1-3H3,(H,20,22) |
| InChIKey | WUIMSHYSOWAEFN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|