C24H37N3O6 — CID 39611533
ethyl 4-[4-[(4-butoxy-3-methoxybenzoyl)amino]butanoylamino]piperidine-1-carboxylate (PubChem CID 39611533) has the molecular formula C24H37N3O6 and a molecular weight of 463.58 g/mol. Its IUPAC name is ethyl 4-[4-[(4-butoxy-3-methoxybenzoyl)amino]butanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-[(4-butoxy-3-methoxybenzoyl)amino]butanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 39611533 |
| Molecular Formula | C24H37N3O6 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | ethyl 4-[4-[(4-butoxy-3-methoxybenzoyl)amino]butanoylamino]piperidine-1-carboxylate |
| SMILES | CCCCOc1ccc(C(=O)NCCCC(=O)NC2CCN(C(=O)OCC)CC2)cc1OC |
| InChI | InChI=1S/C24H37N3O6/c1-4-6-16-33-20-10-9-18(17-21(20)31-3)23(29)25-13-7-8-22(28)26-19-11-14-27(15-12-19)24(30)32-5-2/h9-10,17,19H,4-8,11-16H2,1-3H3,(H,25,29)(H,26,28) |
| InChIKey | PERQGFLHHVRYDK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|