C26H41N3O6 — CID 39611540
ethyl 4-[4-[(4-hexoxy-3-methoxybenzoyl)amino]butanoylamino]piperidine-1-carboxylate (PubChem CID 39611540) has the molecular formula C26H41N3O6 and a molecular weight of 491.63 g/mol. Its IUPAC name is ethyl 4-[4-[(4-hexoxy-3-methoxybenzoyl)amino]butanoylamino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[4-[(4-hexoxy-3-methoxybenzoyl)amino]butanoylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 39611540 |
| Molecular Formula | C26H41N3O6 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.30 |
| IUPAC Name | ethyl 4-[4-[(4-hexoxy-3-methoxybenzoyl)amino]butanoylamino]piperidine-1-carboxylate |
| SMILES | CCCCCCOc1ccc(C(=O)NCCCC(=O)NC2CCN(C(=O)OCC)CC2)cc1OC |
| InChI | InChI=1S/C26H41N3O6/c1-4-6-7-8-18-35-22-12-11-20(19-23(22)33-3)25(31)27-15-9-10-24(30)28-21-13-16-29(17-14-21)26(32)34-5-2/h11-12,19,21H,4-10,13-18H2,1-3H3,(H,27,31)(H,28,30) |
| InChIKey | OPPZBOLUHSGAGH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|