C22H32N2O5 — CID 43010695
ethyl 4-[[(E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoyl]amino]piperidine-1-carboxylate (PubChem CID 43010695) has the molecular formula C22H32N2O5 and a molecular weight of 404.51 g/mol. Its IUPAC name is ethyl 4-[[(E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[(E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 43010695 |
| Molecular Formula | C22H32N2O5 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | ethyl 4-[[(E)-3-(4-butoxy-3-methoxyphenyl)prop-2-enoyl]amino]piperidine-1-carboxylate |
| SMILES | CCCCOc1ccc(/C=C/C(=O)NC2CCN(C(=O)OCC)CC2)cc1OC |
| InChI | InChI=1S/C22H32N2O5/c1-4-6-15-29-19-9-7-17(16-20(19)27-3)8-10-21(25)23-18-11-13-24(14-12-18)22(26)28-5-2/h7-10,16,18H,4-6,11-15H2,1-3H3,(H,23,25)/b10-8+ |
| InChIKey | FSKVUZANTHQAIN-CSKARUKUSA-N |
| XLogP | 3.62 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|