C19H25ClN2O5 — CID 31542300
ethyl 4-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]piperidine-1-carboxylate (PubChem CID 31542300) has the molecular formula C19H25ClN2O5 and a molecular weight of 396.87 g/mol. Its IUPAC name is ethyl 4-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 31542300 |
| Molecular Formula | C19H25ClN2O5 |
| Molecular Weight | 396.87 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | ethyl 4-[[(E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)/C=C/c2cc(Cl)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C19H25ClN2O5/c1-4-27-19(24)22-9-7-14(8-10-22)21-17(23)6-5-13-11-15(20)18(26-3)16(12-13)25-2/h5-6,11-12,14H,4,7-10H2,1-3H3,(H,21,23)/b6-5+ |
| InChIKey | WGESJINGLBMECQ-AATRIKPKSA-N |
| XLogP | 3.11 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.87 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|