C19H24ClNO5 — CID 2492928
[2-(4-methylpiperidin-1-yl)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 2492928) has the molecular formula C19H24ClNO5 and a molecular weight of 381.86 g/mol. Its IUPAC name is [2-(4-methylpiperidin-1-yl)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 2492928 |
| Molecular Formula | C19H24ClNO5 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | [2-(4-methylpiperidin-1-yl)-2-oxoethyl] (E)-3-(3-chloro-4,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)OCC(=O)N2CCC(C)CC2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H24ClNO5/c1-13-6-8-21(9-7-13)17(22)12-26-18(23)5-4-14-10-15(20)19(25-3)16(11-14)24-2/h4-5,10-11,13H,6-9,12H2,1-3H3/b5-4+ |
| InChIKey | UOGJPHASLWAMBN-SNAWJCMRSA-N |
| XLogP | 3.17 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|