C18H25ClN2O3 — CID 122147966
(E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-(methylaminomethyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 122147966) has the molecular formula C18H25ClN2O3 and a molecular weight of 352.86 g/mol. Its IUPAC name is (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-(methylaminomethyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-(methylaminomethyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122147966 |
| Molecular Formula | C18H25ClN2O3 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | (E)-3-(3-chloro-4,5-dimethoxyphenyl)-1-[4-(methylaminomethyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | CNCC1CCN(C(=O)/C=C/c2cc(Cl)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C18H25ClN2O3/c1-20-12-13-6-8-21(9-7-13)17(22)5-4-14-10-15(19)18(24-3)16(11-14)23-2/h4-5,10-11,13,20H,6-9,12H2,1-3H3/b5-4+ |
| InChIKey | YZKMSUVPQORVMW-SNAWJCMRSA-N |
| XLogP | 2.83 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|