C19H24ClNO5 — CID 47004983
methyl 1-[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]piperidine-4-carboxylate (PubChem CID 47004983) has the molecular formula C19H24ClNO5 and a molecular weight of 381.86 g/mol. Its IUPAC name is methyl 1-[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 47004983 |
| Molecular Formula | C19H24ClNO5 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | methyl 1-[(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)prop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CCOc1cc(/C=C/C(=O)N2CCC(C(=O)OC)CC2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H24ClNO5/c1-4-26-16-12-13(11-15(20)18(16)24-2)5-6-17(22)21-9-7-14(8-10-21)19(23)25-3/h5-6,11-12,14H,4,7-10H2,1-3H3/b6-5+ |
| InChIKey | QCPQRJXZBYOCCV-AATRIKPKSA-N |
| XLogP | 3.17 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|