C26H30ClNO4 — CID 55978664
3-(3-chloro-5-methoxy-4-propoxyphenyl)-1-[4-(4-methylbenzoyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 55978664) has the molecular formula C26H30ClNO4 and a molecular weight of 455.98 g/mol. Its IUPAC name is 3-(3-chloro-5-methoxy-4-propoxyphenyl)-1-[4-(4-methylbenzoyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(3-chloro-5-methoxy-4-propoxyphenyl)-1-[4-(4-methylbenzoyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55978664 |
| Molecular Formula | C26H30ClNO4 |
| Molecular Weight | 455.98 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 3-(3-chloro-5-methoxy-4-propoxyphenyl)-1-[4-(4-methylbenzoyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | CCCOc1c(Cl)cc(C=CC(=O)N2CCC(C(=O)c3ccc(C)cc3)CC2)cc1OC |
| InChI | InChI=1S/C26H30ClNO4/c1-4-15-32-26-22(27)16-19(17-23(26)31-3)7-10-24(29)28-13-11-21(12-14-28)25(30)20-8-5-18(2)6-9-20/h5-10,16-17,21H,4,11-15H2,1-3H3 |
| InChIKey | JDEUJGXEDBUZKE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.98 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|