C25H35ClN2O4 — CID 51942883
(E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-1-[4-[(3S)-3-methylpiperidine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 51942883) has the molecular formula C25H35ClN2O4 and a molecular weight of 463.02 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-1-[4-[(3S)-3-methylpiperidine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-1-[4-[(3S)-3-methylpiperidine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 51942883 |
| Molecular Formula | C25H35ClN2O4 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | (E)-3-(3-chloro-5-methoxy-4-propoxyphenyl)-1-[4-[(3S)-3-methylpiperidine-1-carbonyl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | CCCOc1c(Cl)cc(/C=C/C(=O)N2CCC(C(=O)N3CCC[C@H](C)C3)CC2)cc1OC |
| InChI | InChI=1S/C25H35ClN2O4/c1-4-14-32-24-21(26)15-19(16-22(24)31-3)7-8-23(29)27-12-9-20(10-13-27)25(30)28-11-5-6-18(2)17-28/h7-8,15-16,18,20H,4-6,9-14,17H2,1-3H3/b8-7+/t18-/m0/s1 |
| InChIKey | VMCKCSFYYSIOSJ-DVBCCOPCSA-N |
| XLogP | 4.65 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|