C24H33ClN2O4 — CID 55676350
(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-1-[4-(3-methylpiperidine-1-carbonyl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 55676350) has the molecular formula C24H33ClN2O4 and a molecular weight of 448.99 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-1-[4-(3-methylpiperidine-1-carbonyl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-1-[4-(3-methylpiperidine-1-carbonyl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55676350 |
| Molecular Formula | C24H33ClN2O4 |
| Molecular Weight | 448.99 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-1-[4-(3-methylpiperidine-1-carbonyl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | CCOc1cc(/C=C/C(=O)N2CCC(C(=O)N3CCCC(C)C3)CC2)cc(Cl)c1OC |
| InChI | InChI=1S/C24H33ClN2O4/c1-4-31-21-15-18(14-20(25)23(21)30-3)7-8-22(28)26-12-9-19(10-13-26)24(29)27-11-5-6-17(2)16-27/h7-8,14-15,17,19H,4-6,9-13,16H2,1-3H3/b8-7+ |
| InChIKey | ALPIACYQJMVZES-BQYQJAHWSA-N |
| XLogP | 4.26 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.99 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|