C23H23ClN2O3 — CID 41268534
(E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)prop-2-en-1-one (PubChem CID 41268534) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 41268534 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | (E)-3-(3-chloro-5-ethoxy-4-methoxyphenyl)-1-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)prop-2-en-1-one |
| SMILES | CCOc1cc(/C=C/C(=O)N2CCc3[nH]c4ccccc4c3C2)cc(Cl)c1OC |
| InChI | InChI=1S/C23H23ClN2O3/c1-3-29-21-13-15(12-18(24)23(21)28-2)8-9-22(27)26-11-10-20-17(14-26)16-6-4-5-7-19(16)25-20/h4-9,12-13,25H,3,10-11,14H2,1-2H3/b9-8+ |
| InChIKey | XWHNPXIHVFDQOY-CMDGGOBGSA-N |
| XLogP | 4.83 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|