C21H21N3O5 — CID 41269062
(4-ethoxy-5-methoxy-2-nitrophenyl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone (PubChem CID 41269062) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is (4-ethoxy-5-methoxy-2-nitrophenyl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone.
| Compound Name | (4-ethoxy-5-methoxy-2-nitrophenyl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 41269062 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (4-ethoxy-5-methoxy-2-nitrophenyl)-(1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)methanone |
| SMILES | CCOc1cc([N+](=O)[O-])c(C(=O)N2CCc3[nH]c4ccccc4c3C2)cc1OC |
| InChI | InChI=1S/C21H21N3O5/c1-3-29-20-11-18(24(26)27)14(10-19(20)28-2)21(25)23-9-8-17-15(12-23)13-6-4-5-7-16(13)22-17/h4-7,10-11,22H,3,8-9,12H2,1-2H3 |
| InChIKey | DZRSZFZIJHBOGX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|