C21H22N2O6 — CID 143515872
formaldehyde;(5-methoxy-2-nitro-4-phenylmethoxyphenyl)-(3-methylidenepyrrolidin-1-yl)methanone (PubChem CID 143515872) has the molecular formula C21H22N2O6 and a molecular weight of 398.42 g/mol. Its IUPAC name is formaldehyde;(5-methoxy-2-nitro-4-phenylmethoxyphenyl)-(3-methylidenepyrrolidin-1-yl)methanone.
| Compound Name | formaldehyde;(5-methoxy-2-nitro-4-phenylmethoxyphenyl)-(3-methylidenepyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 143515872 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | formaldehyde;(5-methoxy-2-nitro-4-phenylmethoxyphenyl)-(3-methylidenepyrrolidin-1-yl)methanone |
| SMILES | C=C1CCN(C(=O)c2cc(OC)c(OCc3ccccc3)cc2[N+](=O)[O-])C1.C=O |
| InChI | InChI=1S/C20H20N2O5.CH2O/c1-14-8-9-21(12-14)20(23)16-10-18(26-2)19(11-17(16)22(24)25)27-13-15-6-4-3-5-7-15;1-2/h3-7,10-11H,1,8-9,12-13H2,2H3;1H2 |
| InChIKey | SSHXNZNSICAMHB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|