C25H21N3O9 — CID 129406683
methyl (2R)-1-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)-6-nitro-2,3-dihydroindole-2-carboxylate (PubChem CID 129406683) has the molecular formula C25H21N3O9 and a molecular weight of 507.46 g/mol. Its IUPAC name is methyl (2R)-1-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)-6-nitro-2,3-dihydroindole-2-carboxylate.
| Compound Name | methyl (2R)-1-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)-6-nitro-2,3-dihydroindole-2-carboxylate |
|---|---|
| PubChem CID | 129406683 |
| Molecular Formula | C25H21N3O9 |
| Molecular Weight | 507.46 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | methyl (2R)-1-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)-6-nitro-2,3-dihydroindole-2-carboxylate |
| SMILES | COC(=O)[C@H]1Cc2ccc([N+](=O)[O-])cc2N1C(=O)c1cc(OC)c(OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H21N3O9/c1-35-22-12-18(20(28(33)34)13-23(22)37-14-15-6-4-3-5-7-15)24(29)26-19-11-17(27(31)32)9-8-16(19)10-21(26)25(30)36-2/h3-9,11-13,21H,10,14H2,1-2H3/t21-/m1/s1 |
| InChIKey | HYOWBZKZJBSGIN-OAQYLSRUSA-N |
| XLogP | 3.84 |
| TPSA | 151.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|