C21H23N3O9 — CID 88664600
methyl (2S)-4-hydroxy-1-[[5-methoxy-2-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methyl]pyrrolidine-2-carboxylate (PubChem CID 88664600) has the molecular formula C21H23N3O9 and a molecular weight of 461.43 g/mol. Its IUPAC name is methyl (2S)-4-hydroxy-1-[[5-methoxy-2-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-4-hydroxy-1-[[5-methoxy-2-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 88664600 |
| Molecular Formula | C21H23N3O9 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | methyl (2S)-4-hydroxy-1-[[5-methoxy-2-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(O)CN1Cc1cc(OC)c(OCc2ccc([N+](=O)[O-])cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23N3O9/c1-31-19-7-14(10-22-11-16(25)8-18(22)21(26)32-2)17(24(29)30)9-20(19)33-12-13-3-5-15(6-4-13)23(27)28/h3-7,9,16,18,25H,8,10-12H2,1-2H3/t16?,18-/m0/s1 |
| InChIKey | AOMZFKAVKLNGEU-DAFXYXGESA-N |
| XLogP | 2.20 |
| TPSA | 154.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|