C20H20N2O8 — CID 59440076
methyl (4S)-3-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)-1,3-oxazolidine-4-carboxylate (PubChem CID 59440076) has the molecular formula C20H20N2O8 and a molecular weight of 416.39 g/mol. Its IUPAC name is methyl (4S)-3-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)-1,3-oxazolidine-4-carboxylate.
| Compound Name | methyl (4S)-3-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)-1,3-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 59440076 |
| Molecular Formula | C20H20N2O8 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | methyl (4S)-3-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)-1,3-oxazolidine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1COCN1C(=O)c1cc(OC)c(OCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H20N2O8/c1-27-17-8-14(19(23)21-12-29-11-16(21)20(24)28-2)15(22(25)26)9-18(17)30-10-13-6-4-3-5-7-13/h3-9,16H,10-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | JSHIPTRBWIBOKC-INIZCTEOSA-N |
| XLogP | 2.15 |
| TPSA | 117.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|