C20H20N2O6 — CID 163738613
1-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)piperidin-4-one (PubChem CID 163738613) has the molecular formula C20H20N2O6 and a molecular weight of 384.39 g/mol. Its IUPAC name is 1-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)piperidin-4-one.
| Compound Name | 1-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)piperidin-4-one |
|---|---|
| PubChem CID | 163738613 |
| Molecular Formula | C20H20N2O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 1-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)piperidin-4-one |
| SMILES | COc1cc(C(=O)N2CCC(=O)CC2)c([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C20H20N2O6/c1-27-18-11-16(20(24)21-9-7-15(23)8-10-21)17(22(25)26)12-19(18)28-13-14-5-3-2-4-6-14/h2-6,11-12H,7-10,13H2,1H3 |
| InChIKey | LFVDTFLKAHCZDG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|