C21H21IN2O8 — CID 155026021
(2S,4S)-4-hydroxy-2-iodo-1-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)piperidine-2-carboxylic acid (PubChem CID 155026021) has the molecular formula C21H21IN2O8 and a molecular weight of 556.31 g/mol. Its IUPAC name is (2S,4S)-4-hydroxy-2-iodo-1-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)piperidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-hydroxy-2-iodo-1-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 155026021 |
| Molecular Formula | C21H21IN2O8 |
| Molecular Weight | 556.31 g/mol |
| Exact Mass | 556.03 |
| IUPAC Name | (2S,4S)-4-hydroxy-2-iodo-1-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)piperidine-2-carboxylic acid |
| SMILES | COc1cc(C(=O)N2CC[C@H](O)C[C@]2(I)C(=O)O)c([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C21H21IN2O8/c1-31-17-9-15(19(26)23-8-7-14(25)11-21(23,22)20(27)28)16(24(29)30)10-18(17)32-12-13-5-3-2-4-6-13/h2-6,9-10,14,25H,7-8,11-12H2,1H3,(H,27,28)/t14-,21+/m0/s1 |
| InChIKey | XCPHYIXPVIKXFN-LHSJRXKWSA-N |
| XLogP | 3.00 |
| TPSA | 139.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|