C25H22N2O6 — CID 142459607
(3S)-2-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)-3,4-dihydro-1H-isoquinoline-3-carbaldehyde (PubChem CID 142459607) has the molecular formula C25H22N2O6 and a molecular weight of 446.46 g/mol. Its IUPAC name is (3S)-2-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)-3,4-dihydro-1H-isoquinoline-3-carbaldehyde.
| Compound Name | (3S)-2-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)-3,4-dihydro-1H-isoquinoline-3-carbaldehyde |
|---|---|
| PubChem CID | 142459607 |
| Molecular Formula | C25H22N2O6 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (3S)-2-(5-methoxy-2-nitro-4-phenylmethoxybenzoyl)-3,4-dihydro-1H-isoquinoline-3-carbaldehyde |
| SMILES | COc1cc(C(=O)N2Cc3ccccc3C[C@H]2C=O)c([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C25H22N2O6/c1-32-23-12-21(22(27(30)31)13-24(23)33-16-17-7-3-2-4-8-17)25(29)26-14-19-10-6-5-9-18(19)11-20(26)15-28/h2-10,12-13,15,20H,11,14,16H2,1H3/t20-/m0/s1 |
| InChIKey | MNFOSCSHZBUEMG-FQEVSTJZSA-N |
| XLogP | 3.95 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|