C20H25N3O5 — CID 119106640
2-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylamino]-N-propan-2-ylacetamide (PubChem CID 119106640) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 119106640 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-[(5-methoxy-2-nitro-4-phenylmethoxyphenyl)methylamino]-N-propan-2-ylacetamide |
| SMILES | COc1cc(CNCC(=O)NC(C)C)c([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C20H25N3O5/c1-14(2)22-20(24)12-21-11-16-9-18(27-3)19(10-17(16)23(25)26)28-13-15-7-5-4-6-8-15/h4-10,14,21H,11-13H2,1-3H3,(H,22,24) |
| InChIKey | XUHFRVFLXFHMQK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|