C15H22N2O8 — CID 154627481
methyl 2-[[4-[2-(2-hydroxyethoxy)ethoxy]-5-methoxy-2-nitrophenyl]methylamino]acetate (PubChem CID 154627481) has the molecular formula C15H22N2O8 and a molecular weight of 358.35 g/mol. Its IUPAC name is methyl 2-[[4-[2-(2-hydroxyethoxy)ethoxy]-5-methoxy-2-nitrophenyl]methylamino]acetate.
| Compound Name | methyl 2-[[4-[2-(2-hydroxyethoxy)ethoxy]-5-methoxy-2-nitrophenyl]methylamino]acetate |
|---|---|
| PubChem CID | 154627481 |
| Molecular Formula | C15H22N2O8 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | methyl 2-[[4-[2-(2-hydroxyethoxy)ethoxy]-5-methoxy-2-nitrophenyl]methylamino]acetate |
| SMILES | COC(=O)CNCc1cc(OC)c(OCCOCCO)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H22N2O8/c1-22-13-7-11(9-16-10-15(19)23-2)12(17(20)21)8-14(13)25-6-5-24-4-3-18/h7-8,16,18H,3-6,9-10H2,1-2H3 |
| InChIKey | FFXLRQRQJRDPMU-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|