C13H15F3N2O6 — CID 120913188
3-[[5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)phenyl]methylamino]propanoic acid (PubChem CID 120913188) has the molecular formula C13H15F3N2O6 and a molecular weight of 352.27 g/mol. Its IUPAC name is 3-[[5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 120913188 |
| Molecular Formula | C13H15F3N2O6 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 3-[[5-methoxy-2-nitro-4-(2,2,2-trifluoroethoxy)phenyl]methylamino]propanoic acid |
| SMILES | COc1cc(CNCCC(=O)O)c([N+](=O)[O-])cc1OCC(F)(F)F |
| InChI | InChI=1S/C13H15F3N2O6/c1-23-10-4-8(6-17-3-2-12(19)20)9(18(21)22)5-11(10)24-7-13(14,15)16/h4-5,17H,2-3,6-7H2,1H3,(H,19,20) |
| InChIKey | LPUDEUYCJJWUKY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|