C13H16F3NO4 — CID 138995261
3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methylamino]propanoic acid (PubChem CID 138995261) has the molecular formula C13H16F3NO4 and a molecular weight of 307.27 g/mol. Its IUPAC name is 3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 138995261 |
| Molecular Formula | C13H16F3NO4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 3-[[3-methoxy-4-(2,2,2-trifluoroethoxy)phenyl]methylamino]propanoic acid |
| SMILES | COc1cc(CNCCC(=O)O)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C13H16F3NO4/c1-20-11-6-9(7-17-5-4-12(18)19)2-3-10(11)21-8-13(14,15)16/h2-3,6,17H,4-5,7-8H2,1H3,(H,18,19) |
| InChIKey | UARKDCAYSXLAMC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|