C13H20ClNO4 — CID 163331515
3-[(3-ethoxy-4-methoxyphenyl)methylamino]propanoic acid;hydrochloride (PubChem CID 163331515) has the molecular formula C13H20ClNO4 and a molecular weight of 289.76 g/mol. Its IUPAC name is 3-[(3-ethoxy-4-methoxyphenyl)methylamino]propanoic acid;hydrochloride.
| Compound Name | 3-[(3-ethoxy-4-methoxyphenyl)methylamino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 163331515 |
| Molecular Formula | C13H20ClNO4 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 3-[(3-ethoxy-4-methoxyphenyl)methylamino]propanoic acid;hydrochloride |
| SMILES | CCOc1cc(CNCCC(=O)O)ccc1OC.Cl |
| InChI | InChI=1S/C13H19NO4.ClH/c1-3-18-12-8-10(4-5-11(12)17-2)9-14-7-6-13(15)16;/h4-5,8,14H,3,6-7,9H2,1-2H3,(H,15,16);1H |
| InChIKey | CMBAEZLDRTXTCH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|