C13H20N2O4 — CID 83211785
2-[(3-ethoxy-4-methoxyphenyl)methylamino]ethyl carbamate (PubChem CID 83211785) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-[(3-ethoxy-4-methoxyphenyl)methylamino]ethyl carbamate.
| Compound Name | 2-[(3-ethoxy-4-methoxyphenyl)methylamino]ethyl carbamate |
|---|---|
| PubChem CID | 83211785 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-[(3-ethoxy-4-methoxyphenyl)methylamino]ethyl carbamate |
| SMILES | CCOc1cc(CNCCOC(N)=O)ccc1OC |
| InChI | InChI=1S/C13H20N2O4/c1-3-18-12-8-10(4-5-11(12)17-2)9-15-6-7-19-13(14)16/h4-5,8,15H,3,6-7,9H2,1-2H3,(H2,14,16) |
| InChIKey | QRHFRYFGMPQJMK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|