C12H18N4O4 — CID 106789955
2-[[4-[(Z)-N'-hydroxycarbamimidoyl]-3-methoxyphenyl]methylamino]ethyl carbamate (PubChem CID 106789955) has the molecular formula C12H18N4O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[[4-[(Z)-N'-hydroxycarbamimidoyl]-3-methoxyphenyl]methylamino]ethyl carbamate.
| Compound Name | 2-[[4-[(Z)-N'-hydroxycarbamimidoyl]-3-methoxyphenyl]methylamino]ethyl carbamate |
|---|---|
| PubChem CID | 106789955 |
| Molecular Formula | C12H18N4O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-[[4-[(Z)-N'-hydroxycarbamimidoyl]-3-methoxyphenyl]methylamino]ethyl carbamate |
| SMILES | COc1cc(CNCCOC(N)=O)ccc1/C(N)=N/O |
| InChI | InChI=1S/C12H18N4O4/c1-19-10-6-8(2-3-9(10)11(13)16-18)7-15-4-5-20-12(14)17/h2-3,6,15,18H,4-5,7H2,1H3,(H2,13,16)(H2,14,17) |
| InChIKey | JNBRERVOPVLSHH-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|