C23H33NO4 — CID 122035822
3-[[4-(1-adamantylmethoxy)-3-ethoxyphenyl]methylamino]propanoic acid (PubChem CID 122035822) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is 3-[[4-(1-adamantylmethoxy)-3-ethoxyphenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-(1-adamantylmethoxy)-3-ethoxyphenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 122035822 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | 3-[[4-(1-adamantylmethoxy)-3-ethoxyphenyl]methylamino]propanoic acid |
| SMILES | CCOc1cc(CNCCC(=O)O)ccc1OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H33NO4/c1-2-27-21-10-16(14-24-6-5-22(25)26)3-4-20(21)28-15-23-11-17-7-18(12-23)9-19(8-17)13-23/h3-4,10,17-19,24H,2,5-9,11-15H2,1H3,(H,25,26) |
| InChIKey | BHDCODMOTUDZHF-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|