C13H22ClNO3 — CID 17291954
2-[(3,4-diethoxyphenyl)methylamino]ethanol;hydrochloride (PubChem CID 17291954) has the molecular formula C13H22ClNO3 and a molecular weight of 275.78 g/mol. Its IUPAC name is 2-[(3,4-diethoxyphenyl)methylamino]ethanol;hydrochloride.
| Compound Name | 2-[(3,4-diethoxyphenyl)methylamino]ethanol;hydrochloride |
|---|---|
| PubChem CID | 17291954 |
| Molecular Formula | C13H22ClNO3 |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-[(3,4-diethoxyphenyl)methylamino]ethanol;hydrochloride |
| SMILES | CCOc1ccc(CNCCO)cc1OCC.Cl |
| InChI | InChI=1S/C13H21NO3.ClH/c1-3-16-12-6-5-11(10-14-7-8-15)9-13(12)17-4-2;/h5-6,9,14-15H,3-4,7-8,10H2,1-2H3;1H |
| InChIKey | OTTPEMBZSXLCJI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|