C16H28ClNO3 — CID 17211681
5-[(3,4-diethoxyphenyl)methylamino]pentan-1-ol;hydrochloride (PubChem CID 17211681) has the molecular formula C16H28ClNO3 and a molecular weight of 317.86 g/mol. Its IUPAC name is 5-[(3,4-diethoxyphenyl)methylamino]pentan-1-ol;hydrochloride.
| Compound Name | 5-[(3,4-diethoxyphenyl)methylamino]pentan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 17211681 |
| Molecular Formula | C16H28ClNO3 |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 5-[(3,4-diethoxyphenyl)methylamino]pentan-1-ol;hydrochloride |
| SMILES | CCOc1ccc(CNCCCCCO)cc1OCC.Cl |
| InChI | InChI=1S/C16H27NO3.ClH/c1-3-19-15-9-8-14(12-16(15)20-4-2)13-17-10-6-5-7-11-18;/h8-9,12,17-18H,3-7,10-11,13H2,1-2H3;1H |
| InChIKey | JCUHRORGBMFOMT-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|