C15H25NO3 — CID 17206733
5-[(4-ethoxy-3-methoxyphenyl)methylamino]pentan-1-ol (PubChem CID 17206733) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 5-[(4-ethoxy-3-methoxyphenyl)methylamino]pentan-1-ol.
| Compound Name | 5-[(4-ethoxy-3-methoxyphenyl)methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 17206733 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 5-[(4-ethoxy-3-methoxyphenyl)methylamino]pentan-1-ol |
| SMILES | CCOc1ccc(CNCCCCCO)cc1OC |
| InChI | InChI=1S/C15H25NO3/c1-3-19-14-8-7-13(11-15(14)18-2)12-16-9-5-4-6-10-17/h7-8,11,16-17H,3-6,9-10,12H2,1-2H3 |
| InChIKey | KLEHYWWXBKGZGQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|