C16H28ClNO2 — CID 17291147
N-[(3,4-dimethoxyphenyl)methyl]heptan-1-amine;hydrochloride (PubChem CID 17291147) has the molecular formula C16H28ClNO2 and a molecular weight of 301.86 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]heptan-1-amine;hydrochloride.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]heptan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17291147 |
| Molecular Formula | C16H28ClNO2 |
| Molecular Weight | 301.86 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]heptan-1-amine;hydrochloride |
| SMILES | CCCCCCCNCc1ccc(OC)c(OC)c1.Cl |
| InChI | InChI=1S/C16H27NO2.ClH/c1-4-5-6-7-8-11-17-13-14-9-10-15(18-2)16(12-14)19-3;/h9-10,12,17H,4-8,11,13H2,1-3H3;1H |
| InChIKey | AONJLKYWKSBEIT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.86 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|