C15H23F2NO2 — CID 28512615
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]hexan-1-amine (PubChem CID 28512615) has the molecular formula C15H23F2NO2 and a molecular weight of 287.35 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]hexan-1-amine.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]hexan-1-amine |
|---|---|
| PubChem CID | 28512615 |
| Molecular Formula | C15H23F2NO2 |
| Molecular Weight | 287.35 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]hexan-1-amine |
| SMILES | CCCCCCNCc1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C15H23F2NO2/c1-3-4-5-6-9-18-11-12-7-8-13(19-2)14(10-12)20-15(16)17/h7-8,10,15,18H,3-6,9,11H2,1-2H3 |
| InChIKey | IMDQOMYOULKKLJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|