C15H23F2NO3 — CID 29044259
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-propan-2-yloxypropan-1-amine (PubChem CID 29044259) has the molecular formula C15H23F2NO3 and a molecular weight of 303.35 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-propan-2-yloxypropan-1-amine.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-propan-2-yloxypropan-1-amine |
|---|---|
| PubChem CID | 29044259 |
| Molecular Formula | C15H23F2NO3 |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3-propan-2-yloxypropan-1-amine |
| SMILES | COc1ccc(CNCCCOC(C)C)cc1OC(F)F |
| InChI | InChI=1S/C15H23F2NO3/c1-11(2)20-8-4-7-18-10-12-5-6-13(19-3)14(9-12)21-15(16)17/h5-6,9,11,15,18H,4,7-8,10H2,1-3H3 |
| InChIKey | NOZUJBORTQYTLQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|