C14H15F2NO2S — CID 60760352
1-[3-(difluoromethoxy)-4-methoxyphenyl]-N-(thiophen-3-ylmethyl)methanamine (PubChem CID 60760352) has the molecular formula C14H15F2NO2S and a molecular weight of 299.34 g/mol. Its IUPAC name is 1-[3-(difluoromethoxy)-4-methoxyphenyl]-N-(thiophen-3-ylmethyl)methanamine.
| Compound Name | 1-[3-(difluoromethoxy)-4-methoxyphenyl]-N-(thiophen-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 60760352 |
| Molecular Formula | C14H15F2NO2S |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 1-[3-(difluoromethoxy)-4-methoxyphenyl]-N-(thiophen-3-ylmethyl)methanamine |
| SMILES | COc1ccc(CNCc2ccsc2)cc1OC(F)F |
| InChI | InChI=1S/C14H15F2NO2S/c1-18-12-3-2-10(6-13(12)19-14(15)16)7-17-8-11-4-5-20-9-11/h2-6,9,14,17H,7-8H2,1H3 |
| InChIKey | RTQMCOKGWNYGRA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |