C12H18F2N2O4S — CID 102674801
2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]-N-methylethanesulfonamide (PubChem CID 102674801) has the molecular formula C12H18F2N2O4S and a molecular weight of 324.35 g/mol. Its IUPAC name is 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]-N-methylethanesulfonamide.
| Compound Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]-N-methylethanesulfonamide |
|---|---|
| PubChem CID | 102674801 |
| Molecular Formula | C12H18F2N2O4S |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-[[3-(difluoromethoxy)-4-methoxyphenyl]methylamino]-N-methylethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNCc1ccc(OC)c(OC(F)F)c1 |
| InChI | InChI=1S/C12H18F2N2O4S/c1-15-21(17,18)6-5-16-8-9-3-4-10(19-2)11(7-9)20-12(13)14/h3-4,7,12,15-16H,5-6,8H2,1-2H3 |
| InChIKey | XHABBPUXHSABMD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|