C12H14F5NO2 — CID 63226297
N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3,3,3-trifluoropropan-1-amine (PubChem CID 63226297) has the molecular formula C12H14F5NO2 and a molecular weight of 299.24 g/mol. Its IUPAC name is N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3,3,3-trifluoropropan-1-amine.
| Compound Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3,3,3-trifluoropropan-1-amine |
|---|---|
| PubChem CID | 63226297 |
| Molecular Formula | C12H14F5NO2 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-[[3-(difluoromethoxy)-4-methoxyphenyl]methyl]-3,3,3-trifluoropropan-1-amine |
| SMILES | COc1ccc(CNCCC(F)(F)F)cc1OC(F)F |
| InChI | InChI=1S/C12H14F5NO2/c1-19-9-3-2-8(6-10(9)20-11(13)14)7-18-5-4-12(15,16)17/h2-3,6,11,18H,4-5,7H2,1H3 |
| InChIKey | YYPOZYDXZCSFDO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|