C13H22N2O5S — CID 102675085
N-methyl-2-[(3,4,5-trimethoxyphenyl)methylamino]ethanesulfonamide (PubChem CID 102675085) has the molecular formula C13H22N2O5S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-methyl-2-[(3,4,5-trimethoxyphenyl)methylamino]ethanesulfonamide.
| Compound Name | N-methyl-2-[(3,4,5-trimethoxyphenyl)methylamino]ethanesulfonamide |
|---|---|
| PubChem CID | 102675085 |
| Molecular Formula | C13H22N2O5S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-methyl-2-[(3,4,5-trimethoxyphenyl)methylamino]ethanesulfonamide |
| SMILES | CNS(=O)(=O)CCNCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C13H22N2O5S/c1-14-21(16,17)6-5-15-9-10-7-11(18-2)13(20-4)12(8-10)19-3/h7-8,14-15H,5-6,9H2,1-4H3 |
| InChIKey | NUGABFONOBOIBR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|