C15H23NO3 — CID 115629149
(E)-N-[(3,4,5-trimethoxyphenyl)methyl]pent-3-en-1-amine (PubChem CID 115629149) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is (E)-N-[(3,4,5-trimethoxyphenyl)methyl]pent-3-en-1-amine.
| Compound Name | (E)-N-[(3,4,5-trimethoxyphenyl)methyl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 115629149 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | (E)-N-[(3,4,5-trimethoxyphenyl)methyl]pent-3-en-1-amine |
| SMILES | C/C=C/CCNCc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H23NO3/c1-5-6-7-8-16-11-12-9-13(17-2)15(19-4)14(10-12)18-3/h5-6,9-10,16H,7-8,11H2,1-4H3/b6-5+ |
| InChIKey | RDMSEICVKLMOIN-AATRIKPKSA-N |
| XLogP | 2.77 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|