C13H19NO2 — CID 115629089
2-methoxy-5-[[[(E)-pent-3-enyl]amino]methyl]phenol (PubChem CID 115629089) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-methoxy-5-[[[(E)-pent-3-enyl]amino]methyl]phenol.
| Compound Name | 2-methoxy-5-[[[(E)-pent-3-enyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 115629089 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-methoxy-5-[[[(E)-pent-3-enyl]amino]methyl]phenol |
| SMILES | C/C=C/CCNCc1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C13H19NO2/c1-3-4-5-8-14-10-11-6-7-13(16-2)12(15)9-11/h3-4,6-7,9,14-15H,5,8,10H2,1-2H3/b4-3+ |
| InChIKey | JZIAGRQSKBGHNT-ONEGZZNKSA-N |
| XLogP | 2.46 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|