C14H21NO2 — CID 115628979
(E)-N-[(3,5-dimethoxyphenyl)methyl]pent-3-en-1-amine (PubChem CID 115628979) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is (E)-N-[(3,5-dimethoxyphenyl)methyl]pent-3-en-1-amine.
| Compound Name | (E)-N-[(3,5-dimethoxyphenyl)methyl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 115628979 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | (E)-N-[(3,5-dimethoxyphenyl)methyl]pent-3-en-1-amine |
| SMILES | C/C=C/CCNCc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C14H21NO2/c1-4-5-6-7-15-11-12-8-13(16-2)10-14(9-12)17-3/h4-5,8-10,15H,6-7,11H2,1-3H3/b5-4+ |
| InChIKey | VZBJYCOELFBBIL-SNAWJCMRSA-N |
| XLogP | 2.76 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|